C34H21Cl8F4O9P — CID 144525886
[(1S)-1-[3,4-bis[(3,6-dichloro-2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(3,6-dichloro-2-fluorophenyl)methyl] phosphate (PubChem CID 144525886) has the molecular formula C34H21Cl8F4O9P and a molecular weight of 964.12 g/mol. Its IUPAC name is [(1S)-1-[3,4-bis[(3,6-dichloro-2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(3,6-dichloro-2-fluorophenyl)methyl] phosphate.
| Compound Name | [(1S)-1-[3,4-bis[(3,6-dichloro-2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(3,6-dichloro-2-fluorophenyl)methyl] phosphate |
|---|---|
| PubChem CID | 144525886 |
| Molecular Formula | C34H21Cl8F4O9P |
| Molecular Weight | 964.12 g/mol |
| Exact Mass | 959.84 |
| IUPAC Name | [(1S)-1-[3,4-bis[(3,6-dichloro-2-fluorophenyl)methoxy]-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] bis[(3,6-dichloro-2-fluorophenyl)methyl] phosphate |
| SMILES | O=C1OC([C@H](CO)OP(=O)(OCc2c(Cl)ccc(Cl)c2F)OCc2c(Cl)ccc(Cl)c2F)C(OCc2c(Cl)ccc(Cl)c2F)=C1OCc1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C34H21Cl8F4O9P/c35-18-1-5-22(39)27(43)14(18)10-50-32-31(54-34(48)33(32)51-11-15-19(36)2-6-23(40)28(15)44)26(9-47)55-56(49,52-12-16-20(37)3-7-24(41)29(16)45)53-13-17-21(38)4-8-25(42)30(17)46/h1-8,26,31,47H,9-13H2/t26-,31?/m0/s1 |
| InChIKey | VVPXGXKMAFSNTQ-PAMMARIWSA-N |
| XLogP | 12.26 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.12 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|