C25H40 — CID 144528362
(6E,9E,11E,14E,18E)-2,6,10,11,12-pentamethylicosa-2,6,9,11,14,18-hexaene (PubChem CID 144528362) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (6E,9E,11E,14E,18E)-2,6,10,11,12-pentamethylicosa-2,6,9,11,14,18-hexaene.
| Compound Name | (6E,9E,11E,14E,18E)-2,6,10,11,12-pentamethylicosa-2,6,9,11,14,18-hexaene |
|---|---|
| PubChem CID | 144528362 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (6E,9E,11E,14E,18E)-2,6,10,11,12-pentamethylicosa-2,6,9,11,14,18-hexaene |
| SMILES | C/C=C/CC/C=C/C/C(C)=C(C)/C(C)=C/C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40/c1-8-9-10-11-12-13-19-23(5)25(7)24(6)20-15-18-22(4)17-14-16-21(2)3/h8-9,12-13,16,18,20H,10-11,14-15,17,19H2,1-7H3/b9-8+,13-12+,22-18+,24-20+,25-23+ |
| InChIKey | SOWZQBIHHHPTMJ-WVTMZWPFSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|