C9H18O6 — CID 144528460
4-[(1R)-1-(1,1-dihydroxypropan-2-yloxy)ethoxy]butanoic acid (PubChem CID 144528460) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-[(1R)-1-(1,1-dihydroxypropan-2-yloxy)ethoxy]butanoic acid.
| Compound Name | 4-[(1R)-1-(1,1-dihydroxypropan-2-yloxy)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 144528460 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-[(1R)-1-(1,1-dihydroxypropan-2-yloxy)ethoxy]butanoic acid |
| SMILES | CC(OCCCC(=O)O)OC(C)C(O)O |
| InChI | InChI=1S/C9H18O6/c1-6(9(12)13)15-7(2)14-5-3-4-8(10)11/h6-7,9,12-13H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | XYMQVOHYMMZRRR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|