C18H36O6 — CID 144528439
12-[(1R,3R)-1,3-dihydroxy-4-methoxypentoxy]dodecanoic acid (PubChem CID 144528439) has the molecular formula C18H36O6 and a molecular weight of 348.48 g/mol. Its IUPAC name is 12-[(1R,3R)-1,3-dihydroxy-4-methoxypentoxy]dodecanoic acid.
| Compound Name | 12-[(1R,3R)-1,3-dihydroxy-4-methoxypentoxy]dodecanoic acid |
|---|---|
| PubChem CID | 144528439 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 12-[(1R,3R)-1,3-dihydroxy-4-methoxypentoxy]dodecanoic acid |
| SMILES | COC(C)[C@H](O)C[C@H](O)OCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O6/c1-15(23-2)16(19)14-18(22)24-13-11-9-7-5-3-4-6-8-10-12-17(20)21/h15-16,18-19,22H,3-14H2,1-2H3,(H,20,21)/t15?,16-,18-/m1/s1 |
| InChIKey | MMPHBCHRGCYFSR-WOEZKJSCSA-N |
| XLogP | 3.09 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|