About 7-methylperoxyheptanoic acid
7-methylperoxyheptanoic acid (PubChem CID 156663911) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 7-methylperoxyheptanoic acid.
Molecular Properties
| Compound Name | 7-methylperoxyheptanoic acid |
| PubChem CID | 156663911 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 7-methylperoxyheptanoic acid |
| SMILES | COOCCCCCCC(=O)O |
| InChI | InChI=1S/C8H16O4/c1-11-12-7-5-3-2-4-6-8(9)10/h2-7H2,1H3,(H,9,10) |
| InChIKey | WMJGBGSZNDJXPR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 7-methylperoxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylperoxyheptanoic acid?
The IUPAC name of 7-methylperoxyheptanoic acid (CID 156663911) is 7-methylperoxyheptanoic acid.
What is the SMILES notation for 7-methylperoxyheptanoic acid?
The canonical SMILES for 7-methylperoxyheptanoic acid is COOCCCCCCC(=O)O.
What is the InChIKey of 7-methylperoxyheptanoic acid?
The InChIKey is WMJGBGSZNDJXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-11-12-7-5-3-2-4-6-8(9)10/h2-7H2,1H3,(H,9,10).
What are the key properties of 7-methylperoxyheptanoic acid?
7-methylperoxyheptanoic acid has a molecular weight of 176.21 g/mol, XLogP of 1.60, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylperoxyheptanoic acid is sourced from PubChem (CID 156663911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).