C53H43N5 — CID 144531387
5-[(2E)-2-[(Z)-but-2-enylidene]-1-[3-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylideneindol-7-yl]-9-phenyl-4a,9a-dihydrocarbazole (PubChem CID 144531387) has the molecular formula C53H43N5 and a molecular weight of 749.96 g/mol. Its IUPAC name is 5-[(2E)-2-[(Z)-but-2-enylidene]-1-[3-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylideneindol-7-yl]-9-phenyl-4a,9a-dihydrocarbazole.
| Compound Name | 5-[(2E)-2-[(Z)-but-2-enylidene]-1-[3-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylideneindol-7-yl]-9-phenyl-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 144531387 |
| Molecular Formula | C53H43N5 |
| Molecular Weight | 749.96 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | 5-[(2E)-2-[(Z)-but-2-enylidene]-1-[3-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylideneindol-7-yl]-9-phenyl-4a,9a-dihydrocarbazole |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2cccc(-n3/c(=C/C=C\C)c(=C)c4cccc(-c5cccc6c5C5C=CC=CC5N6c5ccccc5)c43)c2)n1 |
| InChI | InChI=1S/C53H43N5/c1-5-7-11-21-36(3)51-54-52(38-22-12-9-13-23-38)56-53(55-51)39-24-18-27-41(35-39)58-46(32-8-6-2)37(4)42-29-19-31-44(50(42)58)43-30-20-34-48-49(43)45-28-16-17-33-47(45)57(48)40-25-14-10-15-26-40/h5-35,45,47H,1,4H2,2-3H3/b8-6-,11-7-,36-21+,46-32+ |
| InChIKey | APNAAYLTJTZUBC-VNHHESHBSA-N |
| XLogP | 11.46 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.96 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|