C5H5ClN4O — CID 144536009
(5-chloropyrimidin-2-yl)urea (PubChem CID 144536009) has the molecular formula C5H5ClN4O and a molecular weight of 172.58 g/mol. Its IUPAC name is (5-chloropyrimidin-2-yl)urea.
| Compound Name | (5-chloropyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 144536009 |
| Molecular Formula | C5H5ClN4O |
| Molecular Weight | 172.58 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | (5-chloropyrimidin-2-yl)urea |
| SMILES | NC(=O)Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C5H5ClN4O/c6-3-1-8-5(9-2-3)10-4(7)11/h1-2H,(H3,7,8,9,10,11) |
| InChIKey | QHLKAHNSJOARNS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.58 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |