C16H23NS2 — CID 144537725
N,4-dimethylthieno[3,2-f][1]benzothiol-8-amine;ethane (PubChem CID 144537725) has the molecular formula C16H23NS2 and a molecular weight of 293.50 g/mol. Its IUPAC name is N,4-dimethylthieno[3,2-f][1]benzothiol-8-amine;ethane.
| Compound Name | N,4-dimethylthieno[3,2-f][1]benzothiol-8-amine;ethane |
|---|---|
| PubChem CID | 144537725 |
| Molecular Formula | C16H23NS2 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N,4-dimethylthieno[3,2-f][1]benzothiol-8-amine;ethane |
| SMILES | CC.CC.CNc1c2sccc2c(C)c2ccsc12 |
| InChI | InChI=1S/C12H11NS2.2C2H6/c1-7-8-3-5-14-11(8)10(13-2)12-9(7)4-6-15-12;2*1-2/h3-6,13H,1-2H3;2*1-2H3 |
| InChIKey | RKFVXLYWTWULLS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |