C26H39N3O2 — CID 144544309
(2E,4Z)-2,5-dimethyl-N-phenylhepta-2,4-dienehydrazide;ethane;N-phenylformamide (PubChem CID 144544309) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is (2E,4Z)-2,5-dimethyl-N-phenylhepta-2,4-dienehydrazide;ethane;N-phenylformamide.
| Compound Name | (2E,4Z)-2,5-dimethyl-N-phenylhepta-2,4-dienehydrazide;ethane;N-phenylformamide |
|---|---|
| PubChem CID | 144544309 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | (2E,4Z)-2,5-dimethyl-N-phenylhepta-2,4-dienehydrazide;ethane;N-phenylformamide |
| SMILES | CC.CC.CC/C(C)=C\C=C(/C)C(=O)N(N)c1ccccc1.O=CNc1ccccc1 |
| InChI | InChI=1S/C15H20N2O.C7H7NO.2C2H6/c1-4-12(2)10-11-13(3)15(18)17(16)14-8-6-5-7-9-14;9-6-8-7-4-2-1-3-5-7;2*1-2/h5-11H,4,16H2,1-3H3;1-6H,(H,8,9);2*1-2H3/b12-10-,13-11+;;; |
| InChIKey | CLBBVZUUKNJNRY-QPCMCGHOSA-N |
| XLogP | 6.50 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|