C16H17N3S — CID 144544550
N-[(Z)-1-[(Z)-[(Z)-but-2-enylidene]amino]prop-1-enyl]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 144544550) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[(Z)-1-[(Z)-[(Z)-but-2-enylidene]amino]prop-1-enyl]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-1-[(Z)-[(Z)-but-2-enylidene]amino]prop-1-enyl]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144544550 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[(Z)-1-[(Z)-[(Z)-but-2-enylidene]amino]prop-1-enyl]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | C/C=C\C=N/C(=C\C)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H17N3S/c1-3-5-11-17-15(4-2)19-16-18-14(12-20-16)13-9-7-6-8-10-13/h3-12H,1-2H3,(H,18,19)/b5-3-,15-4+,17-11- |
| InChIKey | MMTGSIAVGUOPTJ-OHBKGUKHSA-N |
| XLogP | 4.73 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|