C12H11N2OS2- — CID 137332113
(E)-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-sulfanylprop-1-en-1-olate (PubChem CID 137332113) has the molecular formula C12H11N2OS2- and a molecular weight of 263.37 g/mol. Its IUPAC name is (E)-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-sulfanylprop-1-en-1-olate.
| Compound Name | (E)-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-sulfanylprop-1-en-1-olate |
|---|---|
| PubChem CID | 137332113 |
| Molecular Formula | C12H11N2OS2- |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (E)-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-3-sulfanylprop-1-en-1-olate |
| SMILES | [O-]/C(=C/CS)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H12N2OS2/c15-11(6-7-16)14-12-13-10(8-17-12)9-4-2-1-3-5-9/h1-6,8,15-16H,7H2,(H,13,14)/p-1/b11-6+ |
| InChIKey | PAFRMGGGRAUINL-IZZDOVSWSA-M |
| XLogP | 2.35 |
| TPSA | 47.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|