C18H16N4OS — CID 24865723
2-[(2E)-2-benzylidenehydrazinyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 24865723) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[(2E)-2-benzylidenehydrazinyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(2E)-2-benzylidenehydrazinyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24865723 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[(2E)-2-benzylidenehydrazinyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN/N=C/c1ccccc1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H16N4OS/c23-17(12-20-19-11-14-7-3-1-4-8-14)22-18-21-16(13-24-18)15-9-5-2-6-10-15/h1-11,13,20H,12H2,(H,21,22,23)/b19-11+ |
| InChIKey | DMIKQHBHIUFDCM-YBFXNURJSA-N |
| XLogP | 3.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|