C35H38O3 — CID 144550156
phenyl-[4-[6-propan-2-yloxy-3,7-bis(prop-2-enyl)naphthalen-2-yl]oxyphenyl]methanone;propane (PubChem CID 144550156) has the molecular formula C35H38O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is phenyl-[4-[6-propan-2-yloxy-3,7-bis(prop-2-enyl)naphthalen-2-yl]oxyphenyl]methanone;propane.
| Compound Name | phenyl-[4-[6-propan-2-yloxy-3,7-bis(prop-2-enyl)naphthalen-2-yl]oxyphenyl]methanone;propane |
|---|---|
| PubChem CID | 144550156 |
| Molecular Formula | C35H38O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | phenyl-[4-[6-propan-2-yloxy-3,7-bis(prop-2-enyl)naphthalen-2-yl]oxyphenyl]methanone;propane |
| SMILES | C=CCc1cc2cc(OC(C)C)c(CC=C)cc2cc1Oc1ccc(C(=O)c2ccccc2)cc1.CCC |
| InChI | InChI=1S/C32H30O3.C3H8/c1-5-10-25-18-28-21-31(26(11-6-2)19-27(28)20-30(25)34-22(3)4)35-29-16-14-24(15-17-29)32(33)23-12-8-7-9-13-23;1-3-2/h5-9,12-22H,1-2,10-11H2,3-4H3;3H2,1-2H3 |
| InChIKey | AXJCUXLEKJBFPC-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|