C18H22N4S2 — CID 144555862
ethane;3,10,12-trimethyl-N-(thiophen-2-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 144555862) has the molecular formula C18H22N4S2 and a molecular weight of 358.54 g/mol. Its IUPAC name is ethane;3,10,12-trimethyl-N-(thiophen-2-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | ethane;3,10,12-trimethyl-N-(thiophen-2-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 144555862 |
| Molecular Formula | C18H22N4S2 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | ethane;3,10,12-trimethyl-N-(thiophen-2-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | CC.Cc1cc(C)c2c(n1)sc1c(NCc3cccs3)nn(C)c12 |
| InChI | InChI=1S/C16H16N4S2.C2H6/c1-9-7-10(2)18-16-12(9)13-14(22-16)15(19-20(13)3)17-8-11-5-4-6-21-11;1-2/h4-7H,8H2,1-3H3,(H,17,19);1-2H3 |
| InChIKey | XXTJQZYKAWWKLN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |