C20H24N4S — CID 144555850
N-benzyl-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine;ethane (PubChem CID 144555850) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is N-benzyl-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine;ethane.
| Compound Name | N-benzyl-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine;ethane |
|---|---|
| PubChem CID | 144555850 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-benzyl-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine;ethane |
| SMILES | CC.Cc1cc(C)c2c(n1)sc1c(NCc3ccccc3)nn(C)c12 |
| InChI | InChI=1S/C18H18N4S.C2H6/c1-11-9-12(2)20-18-14(11)15-16(23-18)17(21-22(15)3)19-10-13-7-5-4-6-8-13;1-2/h4-9H,10H2,1-3H3,(H,19,21);1-2H3 |
| InChIKey | YGBPZMORQRCIOZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |