C16H15N5S — CID 71516729
3,12-dimethyl-N-(pyridin-4-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine (PubChem CID 71516729) has the molecular formula C16H15N5S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3,12-dimethyl-N-(pyridin-4-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine.
| Compound Name | 3,12-dimethyl-N-(pyridin-4-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
|---|---|
| PubChem CID | 71516729 |
| Molecular Formula | C16H15N5S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3,12-dimethyl-N-(pyridin-4-ylmethyl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
| SMILES | Cc1ccnc2sc3c(NCc4ccncc4)nn(C)c3c12 |
| InChI | InChI=1S/C16H15N5S/c1-10-3-8-18-16-12(10)13-14(22-16)15(20-21(13)2)19-9-11-4-6-17-7-5-11/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | CUDJQBWKHMHZKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |