C16H18N4OS — CID 144555897
ethane;N-(furan-2-ylmethyl)-12-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine (PubChem CID 144555897) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is ethane;N-(furan-2-ylmethyl)-12-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine.
| Compound Name | ethane;N-(furan-2-ylmethyl)-12-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
|---|---|
| PubChem CID | 144555897 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | ethane;N-(furan-2-ylmethyl)-12-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
| SMILES | CC.Cc1ccnc2sc3c(NCc4ccco4)n[nH]c3c12 |
| InChI | InChI=1S/C14H12N4OS.C2H6/c1-8-4-5-15-14-10(8)11-12(20-14)13(18-17-11)16-7-9-3-2-6-19-9;1-2/h2-6H,7H2,1H3,(H2,16,17,18);1-2H3 |
| InChIKey | HUQQNCLBVNHNTN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |