C35H40F2N2O5 — CID 144556145
1-N'-[4-[(1E,3E)-1-(4-ethoxy-3-methoxy-6,6-dimethylcyclohexa-1,3-dien-1-yl)hepta-1,3-dienoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 144556145) has the molecular formula C35H40F2N2O5 and a molecular weight of 606.71 g/mol. Its IUPAC name is 1-N'-[4-[(1E,3E)-1-(4-ethoxy-3-methoxy-6,6-dimethylcyclohexa-1,3-dien-1-yl)hepta-1,3-dienoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[(1E,3E)-1-(4-ethoxy-3-methoxy-6,6-dimethylcyclohexa-1,3-dien-1-yl)hepta-1,3-dienoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144556145 |
| Molecular Formula | C35H40F2N2O5 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 1-N'-[4-[(1E,3E)-1-(4-ethoxy-3-methoxy-6,6-dimethylcyclohexa-1,3-dien-1-yl)hepta-1,3-dienoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCC/C=C/C=C(/Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1F)C1=CC(OC)=C(OCC)CC1(C)C |
| InChI | InChI=1S/C35H40F2N2O5/c1-6-8-9-10-11-28(26-21-30(42-5)31(43-7-2)22-34(26,3)4)44-29-17-16-25(20-27(29)37)39-33(41)35(18-19-35)32(40)38-24-14-12-23(36)13-15-24/h9-17,20-21H,6-8,18-19,22H2,1-5H3,(H,38,40)(H,39,41)/b10-9+,28-11+ |
| InChIKey | DDWUMUCYCVPOBN-DYPIPJAZSA-N |
| XLogP | 8.19 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|