C33H31F2N5O3 — CID 144803880
1-N'-[4-[(E)-1-[3-[3-(ethylaminomethyl)phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 144803880) has the molecular formula C33H31F2N5O3 and a molecular weight of 583.64 g/mol. Its IUPAC name is 1-N'-[4-[(E)-1-[3-[3-(ethylaminomethyl)phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[(E)-1-[3-[3-(ethylaminomethyl)phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144803880 |
| Molecular Formula | C33H31F2N5O3 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 1-N'-[4-[(E)-1-[3-[3-(ethylaminomethyl)phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | [H]/N=C\C=C(\Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1F)c1[nH]ccc1-c1cccc(CNCC)c1 |
| InChI | InChI=1S/C33H31F2N5O3/c1-2-37-20-21-4-3-5-22(18-21)26-13-17-38-30(26)29(12-16-36)43-28-11-10-25(19-27(28)35)40-32(42)33(14-15-33)31(41)39-24-8-6-23(34)7-9-24/h3-13,16-19,36-38H,2,14-15,20H2,1H3,(H,39,41)(H,40,42)/b29-12+,36-16- |
| InChIKey | DFYHOVNAQXSFTL-RVELWHGISA-N |
| XLogP | 6.50 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|