C33H30ClF2N5O3 — CID 144803878
1-N'-[4-[(E)-1-[3-[2-chloro-5-[(dimethylamino)methyl]phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 144803878) has the molecular formula C33H30ClF2N5O3 and a molecular weight of 618.08 g/mol. Its IUPAC name is 1-N'-[4-[(E)-1-[3-[2-chloro-5-[(dimethylamino)methyl]phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[(E)-1-[3-[2-chloro-5-[(dimethylamino)methyl]phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144803878 |
| Molecular Formula | C33H30ClF2N5O3 |
| Molecular Weight | 618.08 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 1-N'-[4-[(E)-1-[3-[2-chloro-5-[(dimethylamino)methyl]phenyl]-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | [H]/N=C/C=C(/Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1F)c1[nH]ccc1-c1cc(CN(C)C)ccc1Cl |
| InChI | InChI=1S/C33H30ClF2N5O3/c1-41(2)19-20-3-9-26(34)25(17-20)24-12-16-38-30(24)29(11-15-37)44-28-10-8-23(18-27(28)36)40-32(43)33(13-14-33)31(42)39-22-6-4-21(35)5-7-22/h3-12,15-18,37-38H,13-14,19H2,1-2H3,(H,39,42)(H,40,43)/b29-11+,37-15+ |
| InChIKey | GXEUMVOFUNWWRT-IYCXPTCFSA-N |
| XLogP | 7.10 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.08 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|