C30H24F3N5O3 — CID 144803896
1-N'-[4-[(E)-1-[3-(3-amino-4-fluorophenyl)-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 144803896) has the molecular formula C30H24F3N5O3 and a molecular weight of 559.55 g/mol. Its IUPAC name is 1-N'-[4-[(E)-1-[3-(3-amino-4-fluorophenyl)-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[(E)-1-[3-(3-amino-4-fluorophenyl)-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144803896 |
| Molecular Formula | C30H24F3N5O3 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 1-N'-[4-[(E)-1-[3-(3-amino-4-fluorophenyl)-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | [H]/N=C/C=C(/Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1F)c1[nH]ccc1-c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C30H24F3N5O3/c31-18-2-4-19(5-3-18)37-28(39)30(11-12-30)29(40)38-20-6-8-25(23(33)16-20)41-26(9-13-34)27-21(10-14-36-27)17-1-7-22(32)24(35)15-17/h1-10,13-16,34,36H,11-12,35H2,(H,37,39)(H,38,40)/b26-9+,34-13+ |
| InChIKey | GOFDRTGGSVTRKL-NURIJZNQSA-N |
| XLogP | 6.11 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|