C50H80N2O2 — CID 144558488
1-(2-hexyldecyl)-3-[1-(2-hexyldecyl)-6-methyl-2-oxo-3H-indol-3-yl]-6-methyl-3H-indol-2-one (PubChem CID 144558488) has the molecular formula C50H80N2O2 and a molecular weight of 741.20 g/mol. Its IUPAC name is 1-(2-hexyldecyl)-3-[1-(2-hexyldecyl)-6-methyl-2-oxo-3H-indol-3-yl]-6-methyl-3H-indol-2-one.
| Compound Name | 1-(2-hexyldecyl)-3-[1-(2-hexyldecyl)-6-methyl-2-oxo-3H-indol-3-yl]-6-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 144558488 |
| Molecular Formula | C50H80N2O2 |
| Molecular Weight | 741.20 g/mol |
| Exact Mass | 740.62 |
| IUPAC Name | 1-(2-hexyldecyl)-3-[1-(2-hexyldecyl)-6-methyl-2-oxo-3H-indol-3-yl]-6-methyl-3H-indol-2-one |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)C(C2C(=O)N(CC(CCCCCC)CCCCCCCC)c3cc(C)ccc32)c2ccc(C)cc21 |
| InChI | InChI=1S/C50H80N2O2/c1-7-11-15-19-21-25-29-41(27-23-17-13-9-3)37-51-45-35-39(5)31-33-43(45)47(49(51)53)48-44-34-32-40(6)36-46(44)52(50(48)54)38-42(28-24-18-14-10-4)30-26-22-20-16-12-8-2/h31-36,41-42,47-48H,7-30,37-38H2,1-6H3 |
| InChIKey | HBFZUWCWIVVOLG-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.20 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|