About N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide
N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide (PubChem CID 144559850) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide.
Molecular Properties
| Compound Name | N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide |
| PubChem CID | 144559850 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide |
| SMILES | N/C=N\c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C8H8N4/c9-5-11-8-3-6-4-10-2-1-7(6)12-8/h1-5,12H,(H2,9,11) |
| InChIKey | YXYPGSBEYSNAIA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide?
The IUPAC name of N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide (CID 144559850) is N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide.
What is the SMILES notation for N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide?
The canonical SMILES for N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide is N/C=N\c1cc2cnccc2[nH]1.
What is the InChIKey of N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide?
The InChIKey is YXYPGSBEYSNAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-5-11-8-3-6-4-10-2-1-7(6)12-8/h1-5,12H,(H2,9,11).
What are the key properties of N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide?
N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide has a molecular weight of 160.18 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide is sourced from PubChem (CID 144559850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).