C8H8N4 — CID 144559850
N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide (PubChem CID 144559850) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide.
| Compound Name | N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide |
|---|---|
| PubChem CID | 144559850 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | N'-(1H-pyrrolo[3,2-c]pyridin-2-yl)methanimidamide |
| SMILES | N/C=N\c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C8H8N4/c9-5-11-8-3-6-4-10-2-1-7(6)12-8/h1-5,12H,(H2,9,11) |
| InChIKey | YXYPGSBEYSNAIA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|