C17H13N3O2 — CID 166457819
3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-1H-1,6-naphthyridin-2-one (PubChem CID 166457819) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-1H-1,6-naphthyridin-2-one.
| Compound Name | 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 166457819 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-1H-1,6-naphthyridin-2-one |
| SMILES | O=C1NCc2ccc(Cc3cc4cnccc4[nH]c3=O)cc21 |
| InChI | InChI=1S/C17H13N3O2/c21-16-12(7-13-8-18-4-3-15(13)20-16)5-10-1-2-11-9-19-17(22)14(11)6-10/h1-4,6-8H,5,9H2,(H,19,22)(H,20,21) |
| InChIKey | NQILWQXIOHLRKR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |