C19H18N2O2 — CID 166457978
3-[[4-(1-hydroxycyclobutyl)phenyl]methyl]-1H-1,6-naphthyridin-2-one (PubChem CID 166457978) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-[[4-(1-hydroxycyclobutyl)phenyl]methyl]-1H-1,6-naphthyridin-2-one.
| Compound Name | 3-[[4-(1-hydroxycyclobutyl)phenyl]methyl]-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 166457978 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-[[4-(1-hydroxycyclobutyl)phenyl]methyl]-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1[nH]c2ccncc2cc1Cc1ccc(C2(O)CCC2)cc1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-14(11-15-12-20-9-6-17(15)21-18)10-13-2-4-16(5-3-13)19(23)7-1-8-19/h2-6,9,11-12,23H,1,7-8,10H2,(H,21,22) |
| InChIKey | CCDAHKCPDASQHM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |