C18H20BrClN2 — CID 144560439
6-bromo-3-chloro-1-[(2,6-dimethylphenyl)methyl]indazole;ethane (PubChem CID 144560439) has the molecular formula C18H20BrClN2 and a molecular weight of 379.73 g/mol. Its IUPAC name is 6-bromo-3-chloro-1-[(2,6-dimethylphenyl)methyl]indazole;ethane.
| Compound Name | 6-bromo-3-chloro-1-[(2,6-dimethylphenyl)methyl]indazole;ethane |
|---|---|
| PubChem CID | 144560439 |
| Molecular Formula | C18H20BrClN2 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 6-bromo-3-chloro-1-[(2,6-dimethylphenyl)methyl]indazole;ethane |
| SMILES | CC.Cc1cccc(C)c1Cn1nc(Cl)c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H14BrClN2.C2H6/c1-10-4-3-5-11(2)14(10)9-20-15-8-12(17)6-7-13(15)16(18)19-20;1-2/h3-8H,9H2,1-2H3;1-2H3 |
| InChIKey | IUWBQXXOYVYNOX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |