C9H15N3 — CID 144562371
N-[(1Z)-1-piperazin-1-ylbuta-1,3-dienyl]methanimine (PubChem CID 144562371) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(1Z)-1-piperazin-1-ylbuta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-piperazin-1-ylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144562371 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-[(1Z)-1-piperazin-1-ylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCNCC1 |
| InChI | InChI=1S/C9H15N3/c1-3-4-9(10-2)12-7-5-11-6-8-12/h3-4,11H,1-2,5-8H2/b9-4+ |
| InChIKey | SCYKHAADVLPWMX-RUDMXATFSA-N |
| XLogP | 0.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|