About 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane
2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane (PubChem CID 144563337) has the molecular formula C16H22BrNO3
and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane.
Molecular Properties
| Compound Name | 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane |
| PubChem CID | 144563337 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane |
| SMILES | C1CC2CC2N1.CC.O=COCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrO3.C5H9N.C2H6/c10-8-3-1-7(2-4-8)9(12)5-13-6-11;1-2-6-5-3-4(1)5;1-2/h1-4,6H,5H2;4-6H,1-3H2;1-2H3 |
| InChIKey | WABBIUQTYLILER-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane?
The IUPAC name of 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane (CID 144563337) is 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane.
What is the SMILES notation for 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane?
The canonical SMILES for 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane is C1CC2CC2N1.CC.O=COCC(=O)c1ccc(Br)cc1.
What is the InChIKey of 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane?
The InChIKey is WABBIUQTYLILER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO3.C5H9N.C2H6/c10-8-3-1-7(2-4-8)9(12)5-13-6-11;1-2-6-5-3-4(1)5;1-2/h1-4,6H,5H2;4-6H,1-3H2;1-2H3.
What are the key properties of 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane?
2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane has a molecular weight of 356.26 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[3.1.0]hexane;[2-(4-bromophenyl)-2-oxoethyl] formate;ethane is sourced from PubChem (CID 144563337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).