C18H24BrNO5 — CID 144878003
[2-(4-bromophenyl)-2-oxoethyl] formate;tert-butyl pyrrolidine-1-carboxylate (PubChem CID 144878003) has the molecular formula C18H24BrNO5 and a molecular weight of 414.30 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] formate;tert-butyl pyrrolidine-1-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] formate;tert-butyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144878003 |
| Molecular Formula | C18H24BrNO5 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] formate;tert-butyl pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.O=COCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrO3.C9H17NO2/c10-8-3-1-7(2-4-8)9(12)5-13-6-11;1-9(2,3)12-8(11)10-6-4-5-7-10/h1-4,6H,5H2;4-7H2,1-3H3 |
| InChIKey | YGWGCWANYBUXBB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|