C22H31ClO4 — CID 144564060
but-2-ene;(2S)-7-chloro-4,6-dimethoxy-2',3',6'-trimethylspiro[1-benzofuran-2,1'-cyclohexane]-3-one (PubChem CID 144564060) has the molecular formula C22H31ClO4 and a molecular weight of 394.94 g/mol. Its IUPAC name is but-2-ene;(2S)-7-chloro-4,6-dimethoxy-2',3',6'-trimethylspiro[1-benzofuran-2,1'-cyclohexane]-3-one.
| Compound Name | but-2-ene;(2S)-7-chloro-4,6-dimethoxy-2',3',6'-trimethylspiro[1-benzofuran-2,1'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 144564060 |
| Molecular Formula | C22H31ClO4 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | but-2-ene;(2S)-7-chloro-4,6-dimethoxy-2',3',6'-trimethylspiro[1-benzofuran-2,1'-cyclohexane]-3-one |
| SMILES | CC=CC.COc1cc(OC)c2c(c1Cl)O[C@@]1(C2=O)C(C)CCC(C)C1C |
| InChI | InChI=1S/C18H23ClO4.C4H8/c1-9-6-7-10(2)18(11(9)3)17(20)14-12(21-4)8-13(22-5)15(19)16(14)23-18;1-3-4-2/h8-11H,6-7H2,1-5H3;3-4H,1-2H3/t9?,10?,11?,18-;/m0./s1 |
| InChIKey | XMJWEBWAYVWUOG-HPZAFXODSA-N |
| XLogP | 5.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|