C25H25ClN2O6 — CID 118263280
(2S,4'R,6'R)-7-chloro-4'-hydroxy-4,6-dimethoxy-3'-(2-methoxyphenyl)-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydro-4H-indazole]-3-one (PubChem CID 118263280) has the molecular formula C25H25ClN2O6 and a molecular weight of 484.94 g/mol. Its IUPAC name is (2S,4'R,6'R)-7-chloro-4'-hydroxy-4,6-dimethoxy-3'-(2-methoxyphenyl)-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydro-4H-indazole]-3-one.
| Compound Name | (2S,4'R,6'R)-7-chloro-4'-hydroxy-4,6-dimethoxy-3'-(2-methoxyphenyl)-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydro-4H-indazole]-3-one |
|---|---|
| PubChem CID | 118263280 |
| Molecular Formula | C25H25ClN2O6 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (2S,4'R,6'R)-7-chloro-4'-hydroxy-4,6-dimethoxy-3'-(2-methoxyphenyl)-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydro-4H-indazole]-3-one |
| SMILES | COc1ccccc1-c1c2c(nn1C)C[C@@H](C)[C@]1(Oc3c(Cl)c(OC)cc(OC)c3C1=O)[C@@H]2O |
| InChI | InChI=1S/C25H25ClN2O6/c1-12-10-14-18(21(28(2)27-14)13-8-6-7-9-15(13)31-3)23(29)25(12)24(30)19-16(32-4)11-17(33-5)20(26)22(19)34-25/h6-9,11-12,23,29H,10H2,1-5H3/t12-,23-,25+/m1/s1 |
| InChIKey | BLGBCZWFQGIQGW-XEVNHFDOSA-N |
| XLogP | 4.01 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |