C24H20Cl2N2O5 — CID 73332239
(2S,6'R)-7-chloro-3'-(2-chlorophenyl)-4,6-dimethoxy-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydroindazole]-3,4'-dione (PubChem CID 73332239) has the molecular formula C24H20Cl2N2O5 and a molecular weight of 487.34 g/mol. Its IUPAC name is (2S,6'R)-7-chloro-3'-(2-chlorophenyl)-4,6-dimethoxy-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydroindazole]-3,4'-dione.
| Compound Name | (2S,6'R)-7-chloro-3'-(2-chlorophenyl)-4,6-dimethoxy-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydroindazole]-3,4'-dione |
|---|---|
| PubChem CID | 73332239 |
| Molecular Formula | C24H20Cl2N2O5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (2S,6'R)-7-chloro-3'-(2-chlorophenyl)-4,6-dimethoxy-2',6'-dimethylspiro[1-benzofuran-2,5'-6,7-dihydroindazole]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C(=O)c2c(nn(C)c2-c2ccccc2Cl)C[C@H]1C |
| InChI | InChI=1S/C24H20Cl2N2O5/c1-11-9-14-17(20(28(2)27-14)12-7-5-6-8-13(12)25)22(29)24(11)23(30)18-15(31-3)10-16(32-4)19(26)21(18)33-24/h5-8,10-11H,9H2,1-4H3/t11-,24+/m1/s1 |
| InChIKey | CROJVDDWOTWJOS-JNDILOIQSA-N |
| XLogP | 4.80 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|