C27H21ClN4O7 — CID 163093469
7-chloro-4,6-dimethoxy-8'-methyl-1'-(pyridin-2-ylmethyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 163093469) has the molecular formula C27H21ClN4O7 and a molecular weight of 548.94 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-8'-methyl-1'-(pyridin-2-ylmethyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | 7-chloro-4,6-dimethoxy-8'-methyl-1'-(pyridin-2-ylmethyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 163093469 |
| Molecular Formula | C27H21ClN4O7 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-8'-methyl-1'-(pyridin-2-ylmethyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)c3cc4c(=O)[nH]c(=O)n(Cc5ccccn5)c4nc3CC1C)C2=O |
| InChI | InChI=1S/C27H21ClN4O7/c1-12-8-16-14(9-15-24(30-16)32(26(36)31-25(15)35)11-13-6-4-5-7-29-13)22(33)27(12)23(34)19-17(37-2)10-18(38-3)20(28)21(19)39-27/h4-7,9-10,12H,8,11H2,1-3H3,(H,31,35,36) |
| InChIKey | OKMCNJKMAZQSJA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|