C19H16ClNO5 — CID 118254223
(2S,7'R)-7-chloro-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-7,8-dihydroquinoline]-3,5'-dione (PubChem CID 118254223) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is (2S,7'R)-7-chloro-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-7,8-dihydroquinoline]-3,5'-dione.
| Compound Name | (2S,7'R)-7-chloro-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-7,8-dihydroquinoline]-3,5'-dione |
|---|---|
| PubChem CID | 118254223 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2S,7'R)-7-chloro-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-7,8-dihydroquinoline]-3,5'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)c3cccnc3C[C@H]1C)C2=O |
| InChI | InChI=1S/C19H16ClNO5/c1-9-7-11-10(5-4-6-21-11)17(22)19(9)18(23)14-12(24-2)8-13(25-3)15(20)16(14)26-19/h4-6,8-9H,7H2,1-3H3/t9-,19+/m1/s1 |
| InChIKey | MCRCXPNRUUZTQP-HOGDKLEQSA-N |
| XLogP | 3.14 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|