C25H20ClNO7 — CID 125430592
(2S,7'R)-7-chloro-4,6-dimethoxy-7',10'-dimethylspiro[1-benzofuran-2,8'-6,7-dihydro-[1,3]benzodioxolo[5,6-b]quinoline]-3,9'-dione (PubChem CID 125430592) has the molecular formula C25H20ClNO7 and a molecular weight of 481.89 g/mol. Its IUPAC name is (2S,7'R)-7-chloro-4,6-dimethoxy-7',10'-dimethylspiro[1-benzofuran-2,8'-6,7-dihydro-[1,3]benzodioxolo[5,6-b]quinoline]-3,9'-dione.
| Compound Name | (2S,7'R)-7-chloro-4,6-dimethoxy-7',10'-dimethylspiro[1-benzofuran-2,8'-6,7-dihydro-[1,3]benzodioxolo[5,6-b]quinoline]-3,9'-dione |
|---|---|
| PubChem CID | 125430592 |
| Molecular Formula | C25H20ClNO7 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (2S,7'R)-7-chloro-4,6-dimethoxy-7',10'-dimethylspiro[1-benzofuran-2,8'-6,7-dihydro-[1,3]benzodioxolo[5,6-b]quinoline]-3,9'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C(=O)c2c(nc3cc4c(cc3c2C)OCO4)C[C@H]1C |
| InChI | InChI=1S/C25H20ClNO7/c1-10-5-14-19(11(2)12-6-15-16(33-9-32-15)7-13(12)27-14)23(28)25(10)24(29)20-17(30-3)8-18(31-4)21(26)22(20)34-25/h6-8,10H,5,9H2,1-4H3/t10-,25+/m1/s1 |
| InChIKey | RQQQHRCDGYOEST-JUTIIYIPSA-N |
| XLogP | 4.33 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|