C30H26ClN3O9 — CID 125427743
(2S,5'S,8'R)-5'-(1,3-benzodioxol-5-yl)-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 125427743) has the molecular formula C30H26ClN3O9 and a molecular weight of 608.00 g/mol. Its IUPAC name is (2S,5'S,8'R)-5'-(1,3-benzodioxol-5-yl)-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | (2S,5'S,8'R)-5'-(1,3-benzodioxol-5-yl)-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 125427743 |
| Molecular Formula | C30H26ClN3O9 |
| Molecular Weight | 608.00 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | (2S,5'S,8'R)-5'-(1,3-benzodioxol-5-yl)-7-chloro-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1c(c(=O)n(C)c(=O)n1C)[C@H]3c1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C30H26ClN3O9/c1-12-8-14-20(25(35)30(12)26(36)21-17(39-4)10-18(40-5)23(31)24(21)43-30)19(13-6-7-15-16(9-13)42-11-41-15)22-27(32-14)33(2)29(38)34(3)28(22)37/h6-7,9-10,12,19,32H,8,11H2,1-5H3/t12-,19+,30+/m1/s1 |
| InChIKey | FCHQWKBMFNYAAD-ZXSLXWSKSA-N |
| XLogP | 2.92 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.00 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|