C29H24Cl2N4O9 — CID 127253850
(2S,8'R)-7-chloro-5'-(4-chloro-3-nitrophenyl)-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 127253850) has the molecular formula C29H24Cl2N4O9 and a molecular weight of 643.44 g/mol. Its IUPAC name is (2S,8'R)-7-chloro-5'-(4-chloro-3-nitrophenyl)-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | (2S,8'R)-7-chloro-5'-(4-chloro-3-nitrophenyl)-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 127253850 |
| Molecular Formula | C29H24Cl2N4O9 |
| Molecular Weight | 643.44 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | (2S,8'R)-7-chloro-5'-(4-chloro-3-nitrophenyl)-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1c(c(=O)n(C)c(=O)n1C)C3c1ccc(Cl)c([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C29H24Cl2N4O9/c1-11-8-14-19(24(36)29(11)25(37)20-16(42-4)10-17(43-5)22(31)23(20)44-29)18(12-6-7-13(30)15(9-12)35(40)41)21-26(32-14)33(2)28(39)34(3)27(21)38/h6-7,9-11,18,32H,8H2,1-5H3/t11-,18?,29+/m1/s1 |
| InChIKey | WKPKANOGRQPWIC-JVHMWFGESA-N |
| XLogP | 3.75 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|