C33H28ClN5O8 — CID 127253987
(2S,8'R)-7-chloro-4,6-dimethoxy-1',3',8'-trimethyl-5'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 127253987) has the molecular formula C33H28ClN5O8 and a molecular weight of 658.07 g/mol. Its IUPAC name is (2S,8'R)-7-chloro-4,6-dimethoxy-1',3',8'-trimethyl-5'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | (2S,8'R)-7-chloro-4,6-dimethoxy-1',3',8'-trimethyl-5'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 127253987 |
| Molecular Formula | C33H28ClN5O8 |
| Molecular Weight | 658.07 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | (2S,8'R)-7-chloro-4,6-dimethoxy-1',3',8'-trimethyl-5'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1c(c(=O)n(C)c(=O)n1C)C3c1cccc(Oc3ncccn3)c1)C2=O |
| InChI | InChI=1S/C33H28ClN5O8/c1-15-12-18-22(27(40)33(15)28(41)23-19(44-4)14-20(45-5)25(34)26(23)47-33)21(24-29(37-18)38(2)32(43)39(3)30(24)42)16-8-6-9-17(13-16)46-31-35-10-7-11-36-31/h6-11,13-15,21,37H,12H2,1-5H3/t15-,21?,33+/m1/s1 |
| InChIKey | MPRDYDZXXCOQCC-XIDNLUAHSA-N |
| XLogP | 3.77 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.07 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|