C29H24ClN3O7 — CID 125430383
(2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125430383) has the molecular formula C29H24ClN3O7 and a molecular weight of 561.98 g/mol. Its IUPAC name is (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125430383 |
| Molecular Formula | C29H24ClN3O7 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3-pyrimidin-2-yloxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@@H]3c1cccc(Oc3ncccn3)c1)C2=O |
| InChI | InChI=1S/C29H24ClN3O7/c1-14-10-18-22(26(35)29(14)27(36)23-19(37-2)13-20(38-3)24(30)25(23)40-29)17(12-21(34)33-18)15-6-4-7-16(11-15)39-28-31-8-5-9-32-28/h4-9,11,13-14,17H,10,12H2,1-3H3,(H,33,34)/t14-,17-,29+/m1/s1 |
| InChIKey | KATMDIGZCZATKZ-WZYUCLQXSA-N |
| XLogP | 4.42 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|