C31H30ClN3O8 — CID 163013020
7-chloro-4,6-dimethoxy-4'-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 163013020) has the molecular formula C31H30ClN3O8 and a molecular weight of 608.05 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-4'-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | 7-chloro-4,6-dimethoxy-4'-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 163013020 |
| Molecular Formula | C31H30ClN3O8 |
| Molecular Weight | 608.05 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-4'-[3-methoxy-4-[(1-methylimidazol-2-yl)methoxy]phenyl]-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(C2CC(=O)NC3=C2C(=O)C2(Oc4c(Cl)c(OC)cc(OC)c4C2=O)C(C)C3)ccc1OCc1nccn1C |
| InChI | InChI=1S/C31H30ClN3O8/c1-15-10-18-25(29(37)31(15)30(38)26-21(40-4)13-22(41-5)27(32)28(26)43-31)17(12-24(36)34-18)16-6-7-19(20(11-16)39-3)42-14-23-33-8-9-35(23)2/h6-9,11,13,15,17H,10,12,14H2,1-5H3,(H,34,36) |
| InChIKey | TVIHOQHCZMZNEV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|