C25H20ClF2NO6 — CID 125428820
(2S,4'S,7'R)-7-chloro-4'-(3,4-difluorophenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125428820) has the molecular formula C25H20ClF2NO6 and a molecular weight of 503.89 g/mol. Its IUPAC name is (2S,4'S,7'R)-7-chloro-4'-(3,4-difluorophenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'S,7'R)-7-chloro-4'-(3,4-difluorophenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125428820 |
| Molecular Formula | C25H20ClF2NO6 |
| Molecular Weight | 503.89 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (2S,4'S,7'R)-7-chloro-4'-(3,4-difluorophenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@H]3c1ccc(F)c(F)c1)C2=O |
| InChI | InChI=1S/C25H20ClF2NO6/c1-10-6-15-19(12(8-18(30)29-15)11-4-5-13(27)14(28)7-11)23(31)25(10)24(32)20-16(33-2)9-17(34-3)21(26)22(20)35-25/h4-5,7,9-10,12H,6,8H2,1-3H3,(H,29,30)/t10-,12+,25+/m1/s1 |
| InChIKey | ZTGPNLBZHDGBSB-JBBSYBRQSA-N |
| XLogP | 4.12 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|