C28H21Cl2NO8 — CID 125429711
(2S,4'S,7'R)-7-chloro-4'-(6-chloro-4-oxochromen-3-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125429711) has the molecular formula C28H21Cl2NO8 and a molecular weight of 570.38 g/mol. Its IUPAC name is (2S,4'S,7'R)-7-chloro-4'-(6-chloro-4-oxochromen-3-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'S,7'R)-7-chloro-4'-(6-chloro-4-oxochromen-3-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125429711 |
| Molecular Formula | C28H21Cl2NO8 |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | (2S,4'S,7'R)-7-chloro-4'-(6-chloro-4-oxochromen-3-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@@H]3c1coc3ccc(Cl)cc3c1=O)C2=O |
| InChI | InChI=1S/C28H21Cl2NO8/c1-11-6-16-21(13(8-20(32)31-16)15-10-38-17-5-4-12(29)7-14(17)24(15)33)26(34)28(11)27(35)22-18(36-2)9-19(37-3)23(30)25(22)39-28/h4-5,7,9-11,13H,6,8H2,1-3H3,(H,31,32)/t11-,13-,28+/m1/s1 |
| InChIKey | KFTYZVHQBIFFOH-WKFBYUJJSA-N |
| XLogP | 4.60 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|