C30H27ClN2O8 — CID 125428566
(2S,4'R,7'R)-7-chloro-4,6-dimethoxy-4'-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125428566) has the molecular formula C30H27ClN2O8 and a molecular weight of 579.01 g/mol. Its IUPAC name is (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-4'-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-4'-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125428566 |
| Molecular Formula | C30H27ClN2O8 |
| Molecular Weight | 579.01 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-4'-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1ccc2cc([C@@H]3CC(=O)NC4=C3C(=O)[C@@]3(Oc5c(Cl)c(OC)cc(OC)c5C3=O)[C@H](C)C4)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C30H27ClN2O8/c1-13-8-18-23(27(35)30(13)28(36)24-20(39-4)12-21(40-5)25(31)26(24)41-30)16(11-22(34)32-18)17-9-14-6-7-15(38-3)10-19(14)33(2)29(17)37/h6-7,9-10,12-13,16H,8,11H2,1-5H3,(H,32,34)/t13-,16+,30+/m1/s1 |
| InChIKey | PHMLJENVVDKMQE-FSCNSMQBSA-N |
| XLogP | 3.70 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.01 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|