C23H20ClNO6S — CID 125428128
(2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-thiophen-3-ylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125428128) has the molecular formula C23H20ClNO6S and a molecular weight of 473.93 g/mol. Its IUPAC name is (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-thiophen-3-ylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-thiophen-3-ylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125428128 |
| Molecular Formula | C23H20ClNO6S |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-thiophen-3-ylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@H]3c1ccsc1)C2=O |
| InChI | InChI=1S/C23H20ClNO6S/c1-10-6-13-17(12(7-16(26)25-13)11-4-5-32-9-11)21(27)23(10)22(28)18-14(29-2)8-15(30-3)19(24)20(18)31-23/h4-5,8-10,12H,6-7H2,1-3H3,(H,25,26)/t10-,12+,23+/m1/s1 |
| InChIKey | WLSUPAILDAYICY-YHBNFXLMSA-N |
| XLogP | 3.90 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|