C27H26ClNO8 — CID 125428063
(2S,4'R,7'R)-7-chloro-4'-(3,4-dimethoxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125428063) has the molecular formula C27H26ClNO8 and a molecular weight of 527.96 g/mol. Its IUPAC name is (2S,4'R,7'R)-7-chloro-4'-(3,4-dimethoxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'R,7'R)-7-chloro-4'-(3,4-dimethoxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125428063 |
| Molecular Formula | C27H26ClNO8 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | (2S,4'R,7'R)-7-chloro-4'-(3,4-dimethoxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1ccc([C@H]2CC(=O)NC3=C2C(=O)[C@@]2(Oc4c(Cl)c(OC)cc(OC)c4C2=O)[C@H](C)C3)cc1OC |
| InChI | InChI=1S/C27H26ClNO8/c1-12-8-15-21(14(10-20(30)29-15)13-6-7-16(33-2)17(9-13)34-3)25(31)27(12)26(32)22-18(35-4)11-19(36-5)23(28)24(22)37-27/h6-7,9,11-12,14H,8,10H2,1-5H3,(H,29,30)/t12-,14-,27+/m1/s1 |
| InChIKey | UNLIKDUXSSCWIM-DARGTVEUSA-N |
| XLogP | 3.86 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|