C25H22ClNO7 — CID 163086170
7-chloro-4'-(4-hydroxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 163086170) has the molecular formula C25H22ClNO7 and a molecular weight of 483.90 g/mol. Its IUPAC name is 7-chloro-4'-(4-hydroxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | 7-chloro-4'-(4-hydroxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 163086170 |
| Molecular Formula | C25H22ClNO7 |
| Molecular Weight | 483.90 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 7-chloro-4'-(4-hydroxyphenyl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C3=C(CC1C)NC(=O)CC3c1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C25H22ClNO7/c1-11-8-15-19(14(9-18(29)27-15)12-4-6-13(28)7-5-12)23(30)25(11)24(31)20-16(32-2)10-17(33-3)21(26)22(20)34-25/h4-7,10-11,14,28H,8-9H2,1-3H3,(H,27,29) |
| InChIKey | AKAAJHLHGPSVDS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|