C28H28ClNO9 — CID 125427870
(2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3,4,5-trimethoxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125427870) has the molecular formula C28H28ClNO9 and a molecular weight of 557.98 g/mol. Its IUPAC name is (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3,4,5-trimethoxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3,4,5-trimethoxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125427870 |
| Molecular Formula | C28H28ClNO9 |
| Molecular Weight | 557.98 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | (2S,4'R,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-(3,4,5-trimethoxyphenyl)spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@@H]3c1cc(OC)c(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C28H28ClNO9/c1-12-7-15-21(14(10-20(31)30-15)13-8-18(36-4)24(38-6)19(9-13)37-5)26(32)28(12)27(33)22-16(34-2)11-17(35-3)23(29)25(22)39-28/h8-9,11-12,14H,7,10H2,1-6H3,(H,30,31)/t12-,14-,28+/m1/s1 |
| InChIKey | LKWCHDJLOHFDCL-YRQPMEPRSA-N |
| XLogP | 3.86 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|