C28H26ClN3O7 — CID 163037971
7-chloro-4'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 163037971) has the molecular formula C28H26ClN3O7 and a molecular weight of 551.98 g/mol. Its IUPAC name is 7-chloro-4'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | 7-chloro-4'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 163037971 |
| Molecular Formula | C28H26ClN3O7 |
| Molecular Weight | 551.98 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 7-chloro-4'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C3=C(CC1C)NC(=O)CC3c1ccc3c(c1)n(C)c(=O)n3C)C2=O |
| InChI | InChI=1S/C28H26ClN3O7/c1-12-8-15-21(14(10-20(33)30-15)13-6-7-16-17(9-13)32(3)27(36)31(16)2)25(34)28(12)26(35)22-18(37-4)11-19(38-5)23(29)24(22)39-28/h6-7,9,11-12,14H,8,10H2,1-5H3,(H,30,33) |
| InChIKey | DMEPDKMWANJWPN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|