C30H26ClNO7 — CID 163092637
7-chloro-4,6-dimethoxy-4'-(4-methoxynaphthalen-1-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 163092637) has the molecular formula C30H26ClNO7 and a molecular weight of 547.99 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-4'-(4-methoxynaphthalen-1-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | 7-chloro-4,6-dimethoxy-4'-(4-methoxynaphthalen-1-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 163092637 |
| Molecular Formula | C30H26ClNO7 |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-4'-(4-methoxynaphthalen-1-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C3=C(CC1C)NC(=O)CC3c1ccc(OC)c3ccccc13)C2=O |
| InChI | InChI=1S/C30H26ClNO7/c1-14-11-19-24(18(12-23(33)32-19)16-9-10-20(36-2)17-8-6-5-7-15(16)17)28(34)30(14)29(35)25-21(37-3)13-22(38-4)26(31)27(25)39-30/h5-10,13-14,18H,11-12H2,1-4H3,(H,32,33) |
| InChIKey | CWQCZGNUARLXDV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|