C29H24ClNO9 — CID 125429218
(2S,4'S,7'R)-7-chloro-4,6-dimethoxy-4'-(6-methoxy-4-oxochromen-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125429218) has the molecular formula C29H24ClNO9 and a molecular weight of 565.96 g/mol. Its IUPAC name is (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-4'-(6-methoxy-4-oxochromen-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-4'-(6-methoxy-4-oxochromen-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125429218 |
| Molecular Formula | C29H24ClNO9 |
| Molecular Weight | 565.96 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-4'-(6-methoxy-4-oxochromen-3-yl)-7'-methylspiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1ccc2occ([C@H]3CC(=O)NC4=C3C(=O)[C@@]3(Oc5c(Cl)c(OC)cc(OC)c5C3=O)[C@H](C)C4)c(=O)c2c1 |
| InChI | InChI=1S/C29H24ClNO9/c1-12-7-17-22(27(34)29(12)28(35)23-19(37-3)10-20(38-4)24(30)26(23)40-29)14(9-21(32)31-17)16-11-39-18-6-5-13(36-2)8-15(18)25(16)33/h5-6,8,10-12,14H,7,9H2,1-4H3,(H,31,32)/t12-,14-,29+/m1/s1 |
| InChIKey | OSMCLKCOCKNQFA-ZLLLFYEHSA-N |
| XLogP | 3.95 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|